C20H30N2O2 — CID 20792134
tert-butyl N-(5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl)carbamate (PubChem CID 20792134) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is tert-butyl N-(5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl)carbamate.
| Compound Name | tert-butyl N-(5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl)carbamate |
|---|---|
| PubChem CID | 20792134 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | tert-butyl N-(5-benzyl-8-methyl-5-azaspiro[2.5]octan-7-yl)carbamate |
| SMILES | CC1C(NC(=O)OC(C)(C)C)CN(Cc2ccccc2)CC12CC2 |
| InChI | InChI=1S/C20H30N2O2/c1-15-17(21-18(23)24-19(2,3)4)13-22(14-20(15)10-11-20)12-16-8-6-5-7-9-16/h5-9,15,17H,10-14H2,1-4H3,(H,21,23) |
| InChIKey | MUCIWXKVMWBVLL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |