C20H30ClN3O3 — CID 91155685
tert-butyl N-[(3S,4S)-1-benzyl-4-(4-chlorobutanoylamino)pyrrolidin-3-yl]carbamate (PubChem CID 91155685) has the molecular formula C20H30ClN3O3 and a molecular weight of 395.93 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S)-1-benzyl-4-(4-chlorobutanoylamino)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S)-1-benzyl-4-(4-chlorobutanoylamino)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 91155685 |
| Molecular Formula | C20H30ClN3O3 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | tert-butyl N-[(3S,4S)-1-benzyl-4-(4-chlorobutanoylamino)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CN(Cc2ccccc2)C[C@@H]1NC(=O)CCCCl |
| InChI | InChI=1S/C20H30ClN3O3/c1-20(2,3)27-19(26)23-17-14-24(12-15-8-5-4-6-9-15)13-16(17)22-18(25)10-7-11-21/h4-6,8-9,16-17H,7,10-14H2,1-3H3,(H,22,25)(H,23,26)/t16-,17-/m0/s1 |
| InChIKey | HECBJTGXHDIBPI-IRXDYDNUSA-N |
| XLogP | 2.90 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|