C20H30BrN3O3 — CID 67133715
tert-butyl N-[1-benzyl-4-(4-bromobutanoylamino)pyrrolidin-3-yl]carbamate (PubChem CID 67133715) has the molecular formula C20H30BrN3O3 and a molecular weight of 440.38 g/mol. Its IUPAC name is tert-butyl N-[1-benzyl-4-(4-bromobutanoylamino)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[1-benzyl-4-(4-bromobutanoylamino)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67133715 |
| Molecular Formula | C20H30BrN3O3 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | tert-butyl N-[1-benzyl-4-(4-bromobutanoylamino)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CN(Cc2ccccc2)CC1NC(=O)CCCBr |
| InChI | InChI=1S/C20H30BrN3O3/c1-20(2,3)27-19(26)23-17-14-24(12-15-8-5-4-6-9-15)13-16(17)22-18(25)10-7-11-21/h4-6,8-9,16-17H,7,10-14H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | PRLOGYWKWPZFBE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|