C18H28N2O6 — CID 175597932
(3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;2,3-dihydroxybutanedioic acid (PubChem CID 175597932) has the molecular formula C18H28N2O6 and a molecular weight of 368.43 g/mol. Its IUPAC name is (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;2,3-dihydroxybutanedioic acid.
| Compound Name | (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 175597932 |
| Molecular Formula | C18H28N2O6 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | (3S,4S)-1-benzyl-N,4-dimethylpiperidin-3-amine;2,3-dihydroxybutanedioic acid |
| SMILES | CN[C@@H]1CN(Cc2ccccc2)CC[C@@H]1C.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C14H22N2.C4H6O6/c1-12-8-9-16(11-14(12)15-2)10-13-6-4-3-5-7-13;5-1(3(7)8)2(6)4(9)10/h3-7,12,14-15H,8-11H2,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t12-,14+;/m0./s1 |
| InChIKey | KFXCOZWNFNYMSC-DSHXVJGRSA-N |
| XLogP | -0.01 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |