C22H34N2O3 — CID 124845023
tert-butyl (2R)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-hydroxy-2-methylpropanoate (PubChem CID 124845023) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl (2R)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-hydroxy-2-methylpropanoate.
| Compound Name | tert-butyl (2R)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 124845023 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl (2R)-3-[[(3aS,4R,6aR)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-hydroxy-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(O)CN[C@@H]1CC[C@H]2CN(Cc3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C22H34N2O3/c1-21(2,3)27-20(25)22(4,26)15-23-19-11-10-17-13-24(14-18(17)19)12-16-8-6-5-7-9-16/h5-9,17-19,23,26H,10-15H2,1-4H3/t17-,18+,19+,22+/m0/s1 |
| InChIKey | BJOOBJUJSMSNNV-JZJXAQOMSA-N |
| XLogP | 2.58 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |