C24H34FN3O3 — CID 66997254
tert-butyl 2-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-4-fluoropyrrolidine-1-carboxylate (PubChem CID 66997254) has the molecular formula C24H34FN3O3 and a molecular weight of 431.55 g/mol. Its IUPAC name is tert-butyl 2-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-4-fluoropyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66997254 |
| Molecular Formula | C24H34FN3O3 |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.26 |
| IUPAC Name | tert-butyl 2-[[(3aR,4S,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamoyl]-4-fluoropyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)CC1C(=O)N[C@H]1CC[C@@H]2CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C24H34FN3O3/c1-24(2,3)31-23(30)28-14-18(25)11-21(28)22(29)26-20-10-9-17-13-27(15-19(17)20)12-16-7-5-4-6-8-16/h4-8,17-21H,9-15H2,1-3H3,(H,26,29)/t17-,18?,19+,20+,21?/m1/s1 |
| InChIKey | GOAJVTZVWSEQSL-MFRDALKKSA-N |
| XLogP | 3.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |