C21H28N2O2 — CID 100894096
(2S)-1-[[(3aS,4R,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-(furan-2-yl)propan-2-ol (PubChem CID 100894096) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2S)-1-[[(3aS,4R,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-(furan-2-yl)propan-2-ol.
| Compound Name | (2S)-1-[[(3aS,4R,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 100894096 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2S)-1-[[(3aS,4R,6aS)-2-benzyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-2-(furan-2-yl)propan-2-ol |
| SMILES | C[C@](O)(CN[C@@H]1CC[C@@H]2CN(Cc3ccccc3)C[C@H]21)c1ccco1 |
| InChI | InChI=1S/C21H28N2O2/c1-21(24,20-8-5-11-25-20)15-22-19-10-9-17-13-23(14-18(17)19)12-16-6-3-2-4-7-16/h2-8,11,17-19,22,24H,9-10,12-15H2,1H3/t17-,18-,19-,21+/m1/s1 |
| InChIKey | QOXZSOFJCWJHBI-XCJLJZCSSA-N |
| XLogP | 2.99 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |