C20H28N4 — CID 99854124
(3aR,4S,6aR)-2-benzyl-N-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 99854124) has the molecular formula C20H28N4 and a molecular weight of 324.47 g/mol. Its IUPAC name is (3aR,4S,6aR)-2-benzyl-N-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | (3aR,4S,6aR)-2-benzyl-N-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 99854124 |
| Molecular Formula | C20H28N4 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (3aR,4S,6aR)-2-benzyl-N-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | CCn1nccc1CN[C@H]1CC[C@H]2CN(Cc3ccccc3)C[C@@H]21 |
| InChI | InChI=1S/C20H28N4/c1-2-24-18(10-11-22-24)12-21-20-9-8-17-14-23(15-19(17)20)13-16-6-4-3-5-7-16/h3-7,10-11,17,19-21H,2,8-9,12-15H2,1H3/t17-,19-,20-/m0/s1 |
| InChIKey | QFTVYFGYGIYQGL-IHPCNDPISA-N |
| XLogP | 2.90 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |