C18H30N4O2 — CID 129429197
tert-butyl N-[(3aR,4R,6aR)-2-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 129429197) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is tert-butyl N-[(3aR,4R,6aR)-2-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,4R,6aR)-2-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 129429197 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | tert-butyl N-[(3aR,4R,6aR)-2-[(2-ethylpyrazol-3-yl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | CCn1nccc1CN1C[C@@H]2CC[C@@H](NC(=O)OC(C)(C)C)[C@H]2C1 |
| InChI | InChI=1S/C18H30N4O2/c1-5-22-14(8-9-19-22)11-21-10-13-6-7-16(15(13)12-21)20-17(23)24-18(2,3)4/h8-9,13,15-16H,5-7,10-12H2,1-4H3,(H,20,23)/t13-,15-,16+/m0/s1 |
| InChIKey | FCAAIRZFWYLOPY-CWRNSKLLSA-N |
| XLogP | 2.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |