C22H29N3O2 — CID 100686143
tert-butyl N-[(3aR,4R,6aR)-2-(quinolin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate (PubChem CID 100686143) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[(3aR,4R,6aR)-2-(quinolin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3aR,4R,6aR)-2-(quinolin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
|---|---|
| PubChem CID | 100686143 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | tert-butyl N-[(3aR,4R,6aR)-2-(quinolin-3-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC[C@H]2CN(Cc3cnc4ccccc4c3)C[C@@H]21 |
| InChI | InChI=1S/C22H29N3O2/c1-22(2,3)27-21(26)24-20-9-8-17-13-25(14-18(17)20)12-15-10-16-6-4-5-7-19(16)23-11-15/h4-7,10-11,17-18,20H,8-9,12-14H2,1-3H3,(H,24,26)/t17-,18-,20+/m0/s1 |
| InChIKey | HIXYJQWLYQXPLW-CMKODMSKSA-N |
| XLogP | 3.97 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |