C24H31N3O — CID 46213112
N-[(3aR,4S,6aS)-2-(pyridin-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-phenylbutanamide (PubChem CID 46213112) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[(3aR,4S,6aS)-2-(pyridin-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-phenylbutanamide.
| Compound Name | N-[(3aR,4S,6aS)-2-(pyridin-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 46213112 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | N-[(3aR,4S,6aS)-2-(pyridin-4-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3-methyl-2-phenylbutanamide |
| SMILES | CC(C)C(C(=O)N[C@H]1CC[C@@H]2CN(Cc3ccncc3)C[C@@H]21)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O/c1-17(2)23(19-6-4-3-5-7-19)24(28)26-22-9-8-20-15-27(16-21(20)22)14-18-10-12-25-13-11-18/h3-7,10-13,17,20-23H,8-9,14-16H2,1-2H3,(H,26,28)/t20-,21+,22+,23?/m1/s1 |
| InChIKey | HUXYJUZVLBYWPQ-ZFSMBLLKSA-N |
| XLogP | 3.85 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |