C27H33F3N2O — CID 90765386
N-[(3aS,4R,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-dimethyl-2-phenylbutanamide (PubChem CID 90765386) has the molecular formula C27H33F3N2O and a molecular weight of 458.57 g/mol. Its IUPAC name is N-[(3aS,4R,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-dimethyl-2-phenylbutanamide.
| Compound Name | N-[(3aS,4R,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-dimethyl-2-phenylbutanamide |
|---|---|
| PubChem CID | 90765386 |
| Molecular Formula | C27H33F3N2O |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | N-[(3aS,4R,6aS)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-dimethyl-2-phenylbutanamide |
| SMILES | CC(C)(C)C(C(=O)N[C@@H]1CC[C@@H]2CN(Cc3cccc(C(F)(F)F)c3)C[C@H]21)c1ccccc1 |
| InChI | InChI=1S/C27H33F3N2O/c1-26(2,3)24(19-9-5-4-6-10-19)25(33)31-23-13-12-20-16-32(17-22(20)23)15-18-8-7-11-21(14-18)27(28,29)30/h4-11,14,20,22-24H,12-13,15-17H2,1-3H3,(H,31,33)/t20-,22-,23-,24?/m1/s1 |
| InChIKey | APYANGNORKRQJE-WEROFJHNSA-N |
| XLogP | 5.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |