C30H31F3N2O — CID 66590279
N-[(3aS,4S,6aR)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-diphenylpropanamide (PubChem CID 66590279) has the molecular formula C30H31F3N2O and a molecular weight of 492.59 g/mol. Its IUPAC name is N-[(3aS,4S,6aR)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[(3aS,4S,6aR)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 66590279 |
| Molecular Formula | C30H31F3N2O |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | N-[(3aS,4S,6aR)-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N[C@H]1CC[C@H]2CN(Cc3cccc(C(F)(F)F)c3)C[C@H]21 |
| InChI | InChI=1S/C30H31F3N2O/c31-30(32,33)25-13-7-8-21(16-25)18-35-19-24-14-15-28(27(24)20-35)34-29(36)17-26(22-9-3-1-4-10-22)23-11-5-2-6-12-23/h1-13,16,24,26-28H,14-15,17-20H2,(H,34,36)/t24-,27+,28-/m0/s1 |
| InChIKey | OTMWNVLRTPAUDW-VCTRFXNDSA-N |
| XLogP | 6.25 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |