C15H17F3N4 — CID 71818697
(3aS,4R,6aR)-4-azido-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 71818697) has the molecular formula C15H17F3N4 and a molecular weight of 310.32 g/mol. Its IUPAC name is (3aS,4R,6aR)-4-azido-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aS,4R,6aR)-4-azido-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 71818697 |
| Molecular Formula | C15H17F3N4 |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | (3aS,4R,6aR)-4-azido-2-[[3-(trifluoromethyl)phenyl]methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | [N-]=[N+]=N[C@@H]1CC[C@H]2CN(Cc3cccc(C(F)(F)F)c3)C[C@H]21 |
| InChI | InChI=1S/C15H17F3N4/c16-15(17,18)12-3-1-2-10(6-12)7-22-8-11-4-5-14(20-21-19)13(11)9-22/h1-3,6,11,13-14H,4-5,7-9H2/t11-,13+,14+/m0/s1 |
| InChIKey | BVZZGECDSQOPBT-IACUBPJLSA-N |
| XLogP | 4.23 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|