C12H16ClF3N2 — CID 119905166
(3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;hydrochloride (PubChem CID 119905166) has the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. Its IUPAC name is (3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;hydrochloride.
| Compound Name | (3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 119905166 |
| Molecular Formula | C12H16ClF3N2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | (3R)-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidin-3-amine;hydrochloride |
| SMILES | Cl.N[C@@H]1CCN(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H15F3N2.ClH/c13-12(14,15)10-3-1-2-9(6-10)7-17-5-4-11(16)8-17;/h1-3,6,11H,4-5,7-8,16H2;1H/t11-;/m1./s1 |
| InChIKey | SWBQFGIYXMDSLA-RFVHGSKJSA-N |
| XLogP | 2.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |