C13H16ClF3N2O — CID 119482994
1-(3-aminopyrrolidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride (PubChem CID 119482994) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 1-(3-aminopyrrolidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride.
| Compound Name | 1-(3-aminopyrrolidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119482994 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-(3-aminopyrrolidin-1-yl)-2-[3-(trifluoromethyl)phenyl]ethanone;hydrochloride |
| SMILES | Cl.NC1CCN(C(=O)Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C13H15F3N2O.ClH/c14-13(15,16)10-3-1-2-9(6-10)7-12(19)18-5-4-11(17)8-18;/h1-3,6,11H,4-5,7-8,17H2;1H |
| InChIKey | OUQZJEVWBHWVII-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |