C15H17F3N2O — CID 126776079
1-[(3S)-3-aminopyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one (PubChem CID 126776079) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is 1-[(3S)-3-aminopyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one.
| Compound Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 126776079 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 1-[(3S)-3-aminopyrrolidin-1-yl]-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
| SMILES | CC(=CC(=O)N1CC[C@H](N)C1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N2O/c1-10(7-14(21)20-6-5-13(19)9-20)11-3-2-4-12(8-11)15(16,17)18/h2-4,7-8,13H,5-6,9,19H2,1H3/t13-/m0/s1 |
| InChIKey | RWGJCIALKQDIJZ-ZDUSSCGKSA-N |
| XLogP | 2.67 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|