C14H14F3NO3S — CID 75408067
(Z)-1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one (PubChem CID 75408067) has the molecular formula C14H14F3NO3S and a molecular weight of 333.33 g/mol. Its IUPAC name is (Z)-1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one.
| Compound Name | (Z)-1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 75408067 |
| Molecular Formula | C14H14F3NO3S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (Z)-1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-[3-(trifluoromethyl)phenyl]but-2-en-1-one |
| SMILES | C/C(=C/C(=O)N1CCCS1(=O)=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO3S/c1-10(8-13(19)18-6-3-7-22(18,20)21)11-4-2-5-12(9-11)14(15,16)17/h2,4-5,8-9H,3,6-7H2,1H3/b10-8- |
| InChIKey | XSEDTDNXGNCHAB-NTMALXAHSA-N |
| XLogP | 2.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|