C14H16F3NO — CID 78783825
(3-methylpiperidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 78783825) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is (3-methylpiperidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | (3-methylpiperidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 78783825 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (3-methylpiperidin-1-yl)-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CC1CCCN(C(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H16F3NO/c1-10-4-3-7-18(9-10)13(19)11-5-2-6-12(8-11)14(15,16)17/h2,5-6,8,10H,3-4,7,9H2,1H3 |
| InChIKey | LEFCYVDJBORUII-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |