C21H20F3NO2S — CID 45200802
(2-methylsulfanylphenyl)-[1-[3-(trifluoromethyl)benzoyl]piperidin-3-yl]methanone (PubChem CID 45200802) has the molecular formula C21H20F3NO2S and a molecular weight of 407.46 g/mol. Its IUPAC name is (2-methylsulfanylphenyl)-[1-[3-(trifluoromethyl)benzoyl]piperidin-3-yl]methanone.
| Compound Name | (2-methylsulfanylphenyl)-[1-[3-(trifluoromethyl)benzoyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 45200802 |
| Molecular Formula | C21H20F3NO2S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | (2-methylsulfanylphenyl)-[1-[3-(trifluoromethyl)benzoyl]piperidin-3-yl]methanone |
| SMILES | CSc1ccccc1C(=O)C1CCCN(C(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H20F3NO2S/c1-28-18-10-3-2-9-17(18)19(26)15-7-5-11-25(13-15)20(27)14-6-4-8-16(12-14)21(22,23)24/h2-4,6,8-10,12,15H,5,7,11,13H2,1H3 |
| InChIKey | ZKSZURGZLUJNQS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |