C22H23F3N2O2 — CID 50804308
N-(2,4-dimethylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide (PubChem CID 50804308) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50804308 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[3-(trifluoromethyl)benzoyl]piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN(C(=O)c3cccc(C(F)(F)F)c3)C2)c(C)c1 |
| InChI | InChI=1S/C22H23F3N2O2/c1-14-8-9-19(15(2)11-14)26-20(28)17-6-4-10-27(13-17)21(29)16-5-3-7-18(12-16)22(23,24)25/h3,5,7-9,11-12,17H,4,6,10,13H2,1-2H3,(H,26,28) |
| InChIKey | PQOQRNSRIXFJOS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |