C23H28N2O2 — CID 94082819
(3R)-1-(3,5-dimethylbenzoyl)-N-(2,5-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 94082819) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3R)-1-(3,5-dimethylbenzoyl)-N-(2,5-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-(3,5-dimethylbenzoyl)-N-(2,5-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082819 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | (3R)-1-(3,5-dimethylbenzoyl)-N-(2,5-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCC[C@@H](C(=O)Nc3cc(C)ccc3C)C2)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-15-7-8-18(4)21(13-15)24-22(26)19-6-5-9-25(14-19)23(27)20-11-16(2)10-17(3)12-20/h7-8,10-13,19H,5-6,9,14H2,1-4H3,(H,24,26)/t19-/m1/s1 |
| InChIKey | DAHLJXHGVAAIBW-LJQANCHMSA-N |
| XLogP | 4.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |