C22H25BrN2O2 — CID 94082833
(3S)-N-(4-bromo-3-methylphenyl)-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide (PubChem CID 94082833) has the molecular formula C22H25BrN2O2 and a molecular weight of 429.36 g/mol. Its IUPAC name is (3S)-N-(4-bromo-3-methylphenyl)-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-bromo-3-methylphenyl)-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94082833 |
| Molecular Formula | C22H25BrN2O2 |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | (3S)-N-(4-bromo-3-methylphenyl)-1-(3,5-dimethylbenzoyl)piperidine-3-carboxamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CCC[C@H](C(=O)Nc3ccc(Br)c(C)c3)C2)c1 |
| InChI | InChI=1S/C22H25BrN2O2/c1-14-9-15(2)11-18(10-14)22(27)25-8-4-5-17(13-25)21(26)24-19-6-7-20(23)16(3)12-19/h6-7,9-12,17H,4-5,8,13H2,1-3H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | OQEKEQKTBNZUQJ-KRWDZBQOSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |