C21H22Cl2N2O2 — CID 55631455
1-(3,4-dichlorobenzoyl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide (PubChem CID 55631455) has the molecular formula C21H22Cl2N2O2 and a molecular weight of 405.33 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorobenzoyl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55631455 |
| Molecular Formula | C21H22Cl2N2O2 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)-N-(2,4-dimethylphenyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCCN(C(=O)c3ccc(Cl)c(Cl)c3)C2)c(C)c1 |
| InChI | InChI=1S/C21H22Cl2N2O2/c1-13-5-8-19(14(2)10-13)24-20(26)16-4-3-9-25(12-16)21(27)15-6-7-17(22)18(23)11-15/h5-8,10-11,16H,3-4,9,12H2,1-2H3,(H,24,26) |
| InChIKey | FQQVSUIKKCNCKI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |