C16H20Cl2N2O3 — CID 78862407
1-(3,4-dichlorobenzoyl)-N-(2-hydroxypropyl)piperidine-3-carboxamide (PubChem CID 78862407) has the molecular formula C16H20Cl2N2O3 and a molecular weight of 359.25 g/mol. Its IUPAC name is 1-(3,4-dichlorobenzoyl)-N-(2-hydroxypropyl)piperidine-3-carboxamide.
| Compound Name | 1-(3,4-dichlorobenzoyl)-N-(2-hydroxypropyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 78862407 |
| Molecular Formula | C16H20Cl2N2O3 |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 1-(3,4-dichlorobenzoyl)-N-(2-hydroxypropyl)piperidine-3-carboxamide |
| SMILES | CC(O)CNC(=O)C1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C16H20Cl2N2O3/c1-10(21)8-19-15(22)12-3-2-6-20(9-12)16(23)11-4-5-13(17)14(18)7-11/h4-5,7,10,12,21H,2-3,6,8-9H2,1H3,(H,19,22) |
| InChIKey | IGCFKDJUXOIKTC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |