C21H21Cl3N2O2 — CID 55631090
N-[2-(3-chlorophenyl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide (PubChem CID 55631090) has the molecular formula C21H21Cl3N2O2 and a molecular weight of 439.77 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55631090 |
| Molecular Formula | C21H21Cl3N2O2 |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-1-(3,4-dichlorobenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)C1CCCN(C(=O)c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C21H21Cl3N2O2/c22-17-5-1-3-14(11-17)8-9-25-20(27)16-4-2-10-26(13-16)21(28)15-6-7-18(23)19(24)12-15/h1,3,5-7,11-12,16H,2,4,8-10,13H2,(H,25,27) |
| InChIKey | WIRSDSPUCOHEID-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |