C28H28ClN3O3 — CID 50829376
1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide (PubChem CID 50829376) has the molecular formula C28H28ClN3O3 and a molecular weight of 490.00 g/mol. Its IUPAC name is 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide.
| Compound Name | 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50829376 |
| Molecular Formula | C28H28ClN3O3 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCC(C(=O)NCCc3ccccc3)C2)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H28ClN3O3/c29-24-13-11-21(12-14-24)27(34)31-25-10-4-8-22(18-25)28(35)32-17-5-9-23(19-32)26(33)30-16-15-20-6-2-1-3-7-20/h1-4,6-8,10-14,18,23H,5,9,15-17,19H2,(H,30,33)(H,31,34) |
| InChIKey | NOUWDXWPDMFBGF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |