About 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide
1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide (PubChem CID 50829376) has the molecular formula C28H28ClN3O3
and a molecular weight of 490.00 g/mol. Its IUPAC name is 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide |
| PubChem CID | 50829376 |
| Molecular Formula | C28H28ClN3O3 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide |
| SMILES | C1CC(CN(C1)C(=O)C2=CC(=CC=C2)NC(=O)C3=CC=C(C=C3)Cl)C(=O)NCCC4=CC=CC=C4 |
| InChI | InChI=1S/C28H28ClN3O3/c29-24-13-11-21(12-14-24)27(34)31-25-10-4-8-22(18-25)28(35)32-17-5-9-23(19-32)26(33)30-16-15-20-6-2-1-3-7-20/h1-4,6-8,10-14,18,23H,5,9,15-17,19H2,(H,30,33)(H,31,34) |
| InChIKey | NOUWDXWPDMFBGF-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | 718 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide?
The IUPAC name of 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide (CID 50829376) is 1-[3-[(4-chlorobenzoyl)amino]benzoyl]-N-(2-phenylethyl)piperidine-3-carboxamide.
What is the SMILES notation for 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide?
The canonical SMILES for 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide is C1CC(CN(C1)C(=O)C2=CC(=CC=C2)NC(=O)C3=CC=C(C=C3)Cl)C(=O)NCCC4=CC=CC=C4.
What is the InChIKey of 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide?
The InChIKey is NOUWDXWPDMFBGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28ClN3O3/c29-24-13-11-21(12-14-24)27(34)31-25-10-4-8-22(18-25)28(35)32-17-5-9-23(19-32)26(33)30-16-15-20-6-2-1-3-7-20/h1-4,6-8,10-14,18,23H,5,9,15-17,19H2,(H,30,33)(H,31,34).
What are the key properties of 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide?
1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide has a molecular weight of 490.00 g/mol, XLogP of 4.60, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-{3-[(4-chlorobenzoyl)amino]benzoyl}-N-phenethyl-3-piperidinecarboxamide is sourced from PubChem (CID 50829376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).