C18H16F3NO3 — CID 42392398
[(3S)-1-(furan-3-carbonyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 42392398) has the molecular formula C18H16F3NO3 and a molecular weight of 351.32 g/mol. Its IUPAC name is [(3S)-1-(furan-3-carbonyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3S)-1-(furan-3-carbonyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 42392398 |
| Molecular Formula | C18H16F3NO3 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | [(3S)-1-(furan-3-carbonyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)[C@H]1CCCN(C(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C18H16F3NO3/c19-18(20,21)15-5-1-3-12(9-15)16(23)13-4-2-7-22(10-13)17(24)14-6-8-25-11-14/h1,3,5-6,8-9,11,13H,2,4,7,10H2/t13-/m0/s1 |
| InChIKey | QTTUYSUQQIGBDG-ZDUSSCGKSA-N |
| XLogP | 4.03 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |