C19H22F3NO3 — CID 42565887
oxan-4-yl-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methanone (PubChem CID 42565887) has the molecular formula C19H22F3NO3 and a molecular weight of 369.38 g/mol. Its IUPAC name is oxan-4-yl-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methanone.
| Compound Name | oxan-4-yl-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 42565887 |
| Molecular Formula | C19H22F3NO3 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | oxan-4-yl-[(3S)-3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)[C@H]1CCCN(C(=O)C2CCOCC2)C1 |
| InChI | InChI=1S/C19H22F3NO3/c20-19(21,22)16-5-1-3-14(11-16)17(24)15-4-2-8-23(12-15)18(25)13-6-9-26-10-7-13/h1,3,5,11,13,15H,2,4,6-10,12H2/t15-/m0/s1 |
| InChIKey | IAGPPNWRMQKGBK-HNNXBMFYSA-N |
| XLogP | 3.55 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |