C19H22F3NO4 — CID 45240231
methyl 5-oxo-5-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]pentanoate (PubChem CID 45240231) has the molecular formula C19H22F3NO4 and a molecular weight of 385.38 g/mol. Its IUPAC name is methyl 5-oxo-5-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]pentanoate.
| Compound Name | methyl 5-oxo-5-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]pentanoate |
|---|---|
| PubChem CID | 45240231 |
| Molecular Formula | C19H22F3NO4 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | methyl 5-oxo-5-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]pentanoate |
| SMILES | COC(=O)CCCC(=O)N1CCCC(C(=O)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C19H22F3NO4/c1-27-17(25)9-3-8-16(24)23-10-4-6-14(12-23)18(26)13-5-2-7-15(11-13)19(20,21)22/h2,5,7,11,14H,3-4,6,8-10,12H2,1H3 |
| InChIKey | VPQQAWXDKCTUKY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |