C19H25F3N2O — CID 45206649
[1-(1-methylpiperidin-4-yl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 45206649) has the molecular formula C19H25F3N2O and a molecular weight of 354.42 g/mol. Its IUPAC name is [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 45206649 |
| Molecular Formula | C19H25F3N2O |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | CN1CCC(N2CCCC(C(=O)c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C19H25F3N2O/c1-23-10-7-17(8-11-23)24-9-3-5-15(13-24)18(25)14-4-2-6-16(12-14)19(20,21)22/h2,4,6,12,15,17H,3,5,7-11,13H2,1H3 |
| InChIKey | WATFVIOMNZUQER-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |