C18H20F3N3O — CID 45236227
[1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 45236227) has the molecular formula C18H20F3N3O and a molecular weight of 351.37 g/mol. Its IUPAC name is [1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 45236227 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [1-[(1-methylpyrazol-4-yl)methyl]piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | Cn1cc(CN2CCCC(C(=O)c3cccc(C(F)(F)F)c3)C2)cn1 |
| InChI | InChI=1S/C18H20F3N3O/c1-23-10-13(9-22-23)11-24-7-3-5-15(12-24)17(25)14-4-2-6-16(8-14)18(19,20)21/h2,4,6,8-10,15H,3,5,7,11-12H2,1H3 |
| InChIKey | VGPPPFIWUIXJPT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |