C20H20F3NO2S — CID 45188337
1-[4-[[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 45188337) has the molecular formula C20H20F3NO2S and a molecular weight of 395.45 g/mol. Its IUPAC name is 1-[4-[[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 45188337 |
| Molecular Formula | C20H20F3NO2S |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 1-[4-[[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CCCC(C(=O)c3cccc(C(F)(F)F)c3)C2)cs1 |
| InChI | InChI=1S/C20H20F3NO2S/c1-13(25)18-8-14(12-27-18)10-24-7-3-5-16(11-24)19(26)15-4-2-6-17(9-15)20(21,22)23/h2,4,6,8-9,12,16H,3,5,7,10-11H2,1H3 |
| InChIKey | ABRWXEOFKBRZFP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |