C20H22ClNO2S — CID 42564503
1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone (PubChem CID 42564503) has the molecular formula C20H22ClNO2S and a molecular weight of 375.92 g/mol. Its IUPAC name is 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone.
| Compound Name | 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
|---|---|
| PubChem CID | 42564503 |
| Molecular Formula | C20H22ClNO2S |
| Molecular Weight | 375.92 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]thiophen-2-yl]ethanone |
| SMILES | CC(=O)c1cc(CN2CCC[C@H](C(=O)c3ccc(Cl)cc3C)C2)cs1 |
| InChI | InChI=1S/C20H22ClNO2S/c1-13-8-17(21)5-6-18(13)20(24)16-4-3-7-22(11-16)10-15-9-19(14(2)23)25-12-15/h5-6,8-9,12,16H,3-4,7,10-11H2,1-2H3/t16-/m0/s1 |
| InChIKey | AZSBLCCEONGFJG-INIZCTEOSA-N |
| XLogP | 5.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.92 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |