C23H26ClN3O2 — CID 26395084
1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]phenyl]imidazolidin-2-one (PubChem CID 26395084) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]phenyl]imidazolidin-2-one.
| Compound Name | 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]phenyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 26395084 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 1-[4-[[(3S)-3-(4-chloro-2-methylbenzoyl)piperidin-1-yl]methyl]phenyl]imidazolidin-2-one |
| SMILES | Cc1cc(Cl)ccc1C(=O)[C@H]1CCCN(Cc2ccc(N3CCNC3=O)cc2)C1 |
| InChI | InChI=1S/C23H26ClN3O2/c1-16-13-19(24)6-9-21(16)22(28)18-3-2-11-26(15-18)14-17-4-7-20(8-5-17)27-12-10-25-23(27)29/h4-9,13,18H,2-3,10-12,14-15H2,1H3,(H,25,29)/t18-/m0/s1 |
| InChIKey | CNUABROAFJAPBN-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |