C21H20F3N3O — CID 30853529
[(3R)-1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 30853529) has the molecular formula C21H20F3N3O and a molecular weight of 387.41 g/mol. Its IUPAC name is [(3R)-1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [(3R)-1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 30853529 |
| Molecular Formula | C21H20F3N3O |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | [(3R)-1-(1H-benzimidazol-2-ylmethyl)piperidin-3-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)[C@@H]1CCCN(Cc2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C21H20F3N3O/c22-21(23,24)16-7-3-5-14(11-16)20(28)15-6-4-10-27(12-15)13-19-25-17-8-1-2-9-18(17)26-19/h1-3,5,7-9,11,15H,4,6,10,12-13H2,(H,25,26)/t15-/m1/s1 |
| InChIKey | FQPNSEHHOMCZDP-OAHLLOKOSA-N |
| XLogP | 4.68 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |