C21H27F3N2O3 — CID 45177097
ethyl 4-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 45177097) has the molecular formula C21H27F3N2O3 and a molecular weight of 412.45 g/mol. Its IUPAC name is ethyl 4-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45177097 |
| Molecular Formula | C21H27F3N2O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | ethyl 4-[3-[3-(trifluoromethyl)benzoyl]piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCCC(C(=O)c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C21H27F3N2O3/c1-2-29-20(28)25-11-8-18(9-12-25)26-10-4-6-16(14-26)19(27)15-5-3-7-17(13-15)21(22,23)24/h3,5,7,13,16,18H,2,4,6,8-12,14H2,1H3 |
| InChIKey | XJOSBRGTBLUHIL-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |