C21H29FN2O4 — CID 25457872
ethyl 4-[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 25457872) has the molecular formula C21H29FN2O4 and a molecular weight of 392.47 g/mol. Its IUPAC name is ethyl 4-[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 25457872 |
| Molecular Formula | C21H29FN2O4 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | ethyl 4-[(3S)-3-(5-fluoro-2-methoxybenzoyl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCC[C@H](C(=O)c3cc(F)ccc3OC)C2)CC1 |
| InChI | InChI=1S/C21H29FN2O4/c1-3-28-21(26)23-11-8-17(9-12-23)24-10-4-5-15(14-24)20(25)18-13-16(22)6-7-19(18)27-2/h6-7,13,15,17H,3-5,8-12,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | WBQCJMKUSLQEEF-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |