C24H38N4O3 — CID 45246994
ethyl 4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 45246994) has the molecular formula C24H38N4O3 and a molecular weight of 430.59 g/mol. Its IUPAC name is ethyl 4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45246994 |
| Molecular Formula | C24H38N4O3 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.29 |
| IUPAC Name | ethyl 4-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCCC(N3CCN(c4ccccc4OC)CC3)C2)CC1 |
| InChI | InChI=1S/C24H38N4O3/c1-3-31-24(29)27-13-10-20(11-14-27)28-12-6-7-21(19-28)25-15-17-26(18-16-25)22-8-4-5-9-23(22)30-2/h4-5,8-9,20-21H,3,6-7,10-19H2,1-2H3 |
| InChIKey | MMJNFGBDIGEEEV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |