C23H36N4O2 — CID 45175750
[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone (PubChem CID 45175750) has the molecular formula C23H36N4O2 and a molecular weight of 400.57 g/mol. Its IUPAC name is [3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone.
| Compound Name | [3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 45175750 |
| Molecular Formula | C23H36N4O2 |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | [3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-(1-methylpiperidin-4-yl)methanone |
| SMILES | COc1ccccc1N1CCN(C2CCCN(C(=O)C3CCN(C)CC3)C2)CC1 |
| InChI | InChI=1S/C23H36N4O2/c1-24-12-9-19(10-13-24)23(28)27-11-5-6-20(18-27)25-14-16-26(17-15-25)21-7-3-4-8-22(21)29-2/h3-4,7-8,19-20H,5-6,9-18H2,1-2H3 |
| InChIKey | PNHOSGSMCMTIGZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 39.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |