C23H30N4O2 — CID 42519173
1-[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone (PubChem CID 42519173) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 1-[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone.
| Compound Name | 1-[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
|---|---|
| PubChem CID | 42519173 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 1-[(3R)-3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]-2-pyridin-3-ylethanone |
| SMILES | COc1ccccc1N1CCN([C@@H]2CCCN(C(=O)Cc3cccnc3)C2)CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-29-22-9-3-2-8-21(22)26-14-12-25(13-15-26)20-7-5-11-27(18-20)23(28)16-19-6-4-10-24-17-19/h2-4,6,8-10,17,20H,5,7,11-16,18H2,1H3/t20-/m1/s1 |
| InChIKey | VTOIAYSTIOZQLN-HXUWFJFHSA-N |
| XLogP | 2.45 |
| TPSA | 48.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |