C21H31N3O2 — CID 24719059
cyclobutyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methanone (PubChem CID 24719059) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is cyclobutyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methanone.
| Compound Name | cyclobutyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 24719059 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | cyclobutyl-[3-[4-(2-methoxyphenyl)piperazin-1-yl]piperidin-1-yl]methanone |
| SMILES | COc1ccccc1N1CCN(C2CCCN(C(=O)C3CCC3)C2)CC1 |
| InChI | InChI=1S/C21H31N3O2/c1-26-20-10-3-2-9-19(20)23-14-12-22(13-15-23)18-8-5-11-24(16-18)21(25)17-6-4-7-17/h2-3,9-10,17-18H,4-8,11-16H2,1H3 |
| InChIKey | QBPAZJLCMADGJH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |