C22H36N4O — CID 28786689
1-(2-methoxyphenyl)-4-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]piperazine (PubChem CID 28786689) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-4-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]piperazine.
| Compound Name | 1-(2-methoxyphenyl)-4-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]piperazine |
|---|---|
| PubChem CID | 28786689 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 1-(2-methoxyphenyl)-4-[(3R)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]piperazine |
| SMILES | COc1ccccc1N1CCN([C@@H]2CCCN(C3CCN(C)CC3)C2)CC1 |
| InChI | InChI=1S/C22H36N4O/c1-23-12-9-19(10-13-23)26-11-5-6-20(18-26)24-14-16-25(17-15-24)21-7-3-4-8-22(21)27-2/h3-4,7-8,19-20H,5-6,9-18H2,1-2H3/t20-/m1/s1 |
| InChIKey | XTJNADRCIKHDHR-HXUWFJFHSA-N |
| XLogP | 2.38 |
| TPSA | 22.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |