C19H28N2O3S — CID 45217033
ethyl 4-[3-(3-methylthiophene-2-carbonyl)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 45217033) has the molecular formula C19H28N2O3S and a molecular weight of 364.51 g/mol. Its IUPAC name is ethyl 4-[3-(3-methylthiophene-2-carbonyl)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(3-methylthiophene-2-carbonyl)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 45217033 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | ethyl 4-[3-(3-methylthiophene-2-carbonyl)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCCC(C(=O)c3sccc3C)C2)CC1 |
| InChI | InChI=1S/C19H28N2O3S/c1-3-24-19(23)20-10-6-16(7-11-20)21-9-4-5-15(13-21)17(22)18-14(2)8-12-25-18/h8,12,15-16H,3-7,9-11,13H2,1-2H3 |
| InChIKey | DNEGFABWTHRIIH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |