C18H27N3O3S — CID 75239369
ethyl 4-[3-(thiophene-2-carbonylamino)piperidin-1-yl]piperidine-1-carboxylate (PubChem CID 75239369) has the molecular formula C18H27N3O3S and a molecular weight of 365.50 g/mol. Its IUPAC name is ethyl 4-[3-(thiophene-2-carbonylamino)piperidin-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[3-(thiophene-2-carbonylamino)piperidin-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75239369 |
| Molecular Formula | C18H27N3O3S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | ethyl 4-[3-(thiophene-2-carbonylamino)piperidin-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N2CCCC(NC(=O)c3cccs3)C2)CC1 |
| InChI | InChI=1S/C18H27N3O3S/c1-2-24-18(23)20-10-7-15(8-11-20)21-9-3-5-14(13-21)19-17(22)16-6-4-12-25-16/h4,6,12,14-15H,2-3,5,7-11,13H2,1H3,(H,19,22) |
| InChIKey | NQGIVGGFNIKUAD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |