C13H18N2OS — CID 113223630
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)thiophene-2-carboxamide (PubChem CID 113223630) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)thiophene-2-carboxamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113223630 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)thiophene-2-carboxamide |
| SMILES | O=C(NC1CCN2CCCC2C1)c1cccs1 |
| InChI | InChI=1S/C13H18N2OS/c16-13(12-4-2-8-17-12)14-10-5-7-15-6-1-3-11(15)9-10/h2,4,8,10-11H,1,3,5-7,9H2,(H,14,16) |
| InChIKey | QYZRDLQLWZPLFM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |