C18H28N4OS — CID 167907703
1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(1-thiophen-2-ylpiperidin-4-yl)urea (PubChem CID 167907703) has the molecular formula C18H28N4OS and a molecular weight of 348.52 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(1-thiophen-2-ylpiperidin-4-yl)urea.
| Compound Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(1-thiophen-2-ylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 167907703 |
| Molecular Formula | C18H28N4OS |
| Molecular Weight | 348.52 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | 1-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-3-(1-thiophen-2-ylpiperidin-4-yl)urea |
| SMILES | O=C(NC1CCN(c2cccs2)CC1)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C18H28N4OS/c23-18(20-15-7-9-21-8-1-3-16(21)13-15)19-14-5-10-22(11-6-14)17-4-2-12-24-17/h2,4,12,14-16H,1,3,5-11,13H2,(H2,19,20,23) |
| InChIKey | KCDWLBLRHOLLJB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.52 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |