C16H25Cl2N3O — CID 119854320
2-(4-aminophenyl)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)acetamide;dihydrochloride (PubChem CID 119854320) has the molecular formula C16H25Cl2N3O and a molecular weight of 346.30 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119854320 |
| Molecular Formula | C16H25Cl2N3O |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-(4-aminophenyl)-N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.Nc1ccc(CC(=O)NC2CCN3CCCC3C2)cc1 |
| InChI | InChI=1S/C16H23N3O.2ClH/c17-13-5-3-12(4-6-13)10-16(20)18-14-7-9-19-8-1-2-15(19)11-14;;/h3-6,14-15H,1-2,7-11,17H2,(H,18,20);2*1H |
| InChIKey | LWAMLNGKMPMVFH-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|