C17H25N3O — CID 115341221
3-(4-aminophenyl)-N-(1-cyclopropylpiperidin-4-yl)propanamide (PubChem CID 115341221) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-(4-aminophenyl)-N-(1-cyclopropylpiperidin-4-yl)propanamide.
| Compound Name | 3-(4-aminophenyl)-N-(1-cyclopropylpiperidin-4-yl)propanamide |
|---|---|
| PubChem CID | 115341221 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-(4-aminophenyl)-N-(1-cyclopropylpiperidin-4-yl)propanamide |
| SMILES | Nc1ccc(CCC(=O)NC2CCN(C3CC3)CC2)cc1 |
| InChI | InChI=1S/C17H25N3O/c18-14-4-1-13(2-5-14)3-8-17(21)19-15-9-11-20(12-10-15)16-6-7-16/h1-2,4-5,15-16H,3,6-12,18H2,(H,19,21) |
| InChIKey | AUNFWOFVWNULRA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|