C14H27Cl2N3O — CID 119854358
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-pyrrolidin-2-ylacetamide;dihydrochloride (PubChem CID 119854358) has the molecular formula C14H27Cl2N3O and a molecular weight of 324.30 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-pyrrolidin-2-ylacetamide;dihydrochloride.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-pyrrolidin-2-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119854358 |
| Molecular Formula | C14H27Cl2N3O |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl)-2-pyrrolidin-2-ylacetamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(CC1CCCN1)NC1CCN2CCCC2C1 |
| InChI | InChI=1S/C14H25N3O.2ClH/c18-14(10-11-3-1-6-15-11)16-12-5-8-17-7-2-4-13(17)9-12;;/h11-13,15H,1-10H2,(H,16,18);2*1H |
| InChIKey | IKUKKINXGFMUKK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |